missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Ethyl perfluorooctanoate, 97%, Thermo Scientific™
33.75 EUR - 142.00 EUR
Chemical Identifiers
| CAS | 3108-24-5 |
|---|---|
| Molecular Formula | C10H5F15O2 |
| Molecular Weight (g/mol) | 442.124 |
| MDL Number | MFCD00018063 |
| InChI Key | JTOFFHFAQBLPTM-UHFFFAOYSA-N |
| PubChem CID | 76555 |
| IUPAC Name | ethyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate |
| SMILES | CCOC(=O)C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Description
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 3108-24-5 | |
| 442.124 | |
| JTOFFHFAQBLPTM-UHFFFAOYSA-N | |
| ethyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate |
| C10H5F15O2 | |
| MFCD00018063 | |
| 76555 | |
| CCOC(=O)C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Specifications
| 3108-24-5 | |
| 167°C to 168°C | |
| C10H5F15O2 | |
| 1.311 | |
| 1810008 | |
| JTOFFHFAQBLPTM-UHFFFAOYSA-N | |
| ethyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate | |
| 76555 | |
| 97% |
| 1.626 | |
| None | |
| CF3(CF2)6CO2CH2CH3 | |
| MFCD00018063 | |
| ethyl perfluorooctanoate, ethyl perfluorocaprylate, octanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-, ethyl ester, octanoic acid,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-, ethyl ester, acmc-20akwv, ethyl perfluorooctanoat, ethyl perfluorooctanonate, octanoic acid, pentadecafluoro-, ethyl ester, pentadecafluorooctanoic acid ethyl ester, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-octanoic acid ethyl ester | |
| CCOC(=O)C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F | |
| 442.124 | |
| 442.12 | |
| Ethyl perfluorooctanoate |
Safety and Handling
missing translation for 'einecsNumber' : 221-468-4
missing translation for 'tsca' : Yes
Recommended Storage : Ambient temperatures