missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Di(2-thienyl)-1,1,2,2-tetramethyldisilane, 97%, Thermo Scientific™
61.28 EUR - 184.00 EUR
Chemical Identifiers
| CAS | 124733-24-0 |
|---|---|
| Molecular Formula | C12H18S2Si2 |
| Molecular Weight (g/mol) | 282.57 |
| MDL Number | MFCD09266191 |
| InChI Key | FGYSQQKHYAVZEZ-UHFFFAOYSA-N |
| Synonym | di 2-thienyl-1,1,2,2-tetramethyldisilane, 1,1,2,2-tetramethyl-1,2-bis thiophen-2-yl disilane, bis 2-thienyl-1,1,2,2-tetramethyldisilane, amtsi088, 1,1,2,2-tetramethyl-1,2-di 2-thienyl disilane, 1,1,2,2-tetramethyl-1,2-di thiophen-2-yl disilane |
| PubChem CID | 14382824 |
| IUPAC Name | [dimethyl(thiophen-2-yl)silyl]-dimethyl-thiophen-2-ylsilane |
| SMILES | C[Si](C)(C1=CC=CS1)[Si](C)(C)C1=CC=CS1 |
Description
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 124733-24-0 | |
| 282.57 | |
| FGYSQQKHYAVZEZ-UHFFFAOYSA-N | |
| 14382824 | |
| C[Si](C)(C1=CC=CS1)[Si](C)(C)C1=CC=CS1 |
| C12H18S2Si2 | |
| MFCD09266191 | |
| di 2-thienyl-1,1,2,2-tetramethyldisilane, 1,1,2,2-tetramethyl-1,2-bis thiophen-2-yl disilane, bis 2-thienyl-1,1,2,2-tetramethyldisilane, amtsi088, 1,1,2,2-tetramethyl-1,2-di 2-thienyl disilane, 1,1,2,2-tetramethyl-1,2-di thiophen-2-yl disilane | |
| [dimethyl(thiophen-2-yl)silyl]-dimethyl-thiophen-2-ylsilane |
Specifications
| 42°C to 44°C | |
| C12H18S2Si2 | |
| di 2-thienyl-1,1,2,2-tetramethyldisilane, 1,1,2,2-tetramethyl-1,2-bis thiophen-2-yl disilane, bis 2-thienyl-1,1,2,2-tetramethyldisilane, amtsi088, 1,1,2,2-tetramethyl-1,2-di 2-thienyl disilane, 1,1,2,2-tetramethyl-1,2-di thiophen-2-yl disilane | |
| C[Si](C)(C1=CC=CS1)[Si](C)(C)C1=CC=CS1 | |
| 282.57 | |
| 282.57 | |
| Di(2-thienyl)-1,1,2,2-tetramethyldisilane |
| 124733-24-0 | |
| MFCD09266191 | |
| FGYSQQKHYAVZEZ-UHFFFAOYSA-N | |
| [dimethyl(thiophen-2-yl)silyl]-dimethyl-thiophen-2-ylsilane | |
| 14382824 | |
| 97% |